Gracie725 Gracie725
  • 04-01-2015
  • English
contestada

the practice of islam throughout much of west Africa is evidence that

Respuesta :

Frankwavyy Frankwavyy
  • 04-01-2015
The evidence is that the majority of west Africa practices the religion of Islam.
Answer Link

Otras preguntas

What is one way that “The Maori: Genealogies and Origins in New Zealand” contrasts with “The Raven and the First Men: The Beginnings of the Haida”? The Maori my
idk how to put the picture but can someone just tell me the points where the two dots go plz will give good rate nd say thx plz answer fastGraph -8x-y=8
what is meant by energy?list it various sources​
What is the LCD for x/4 - 2/3 = 7/12?
write the slope- intercept form of the equation for the line.Y=2x-1Y=1/2x-1y=-2x-1y=1/2x+1​
Should we or should we not debunk the myths that hold societies together but that reduce individual happiness
Why photosynthesis can't take place in such an environment , where there is no oxygen..? And exactly why trees need oxygen for photosynthesis ?
who discovered micro organisms​
How to find average acceleration only using displacement and time?
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl