netoisbeautiful6887 netoisbeautiful6887
  • 04-06-2018
  • Mathematics
contestada

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Respuesta :

Аноним Аноним
  • 04-06-2018
We use the identity  sin (A - B) = sin A cos B - cos B sin A

so the above  = sin (11pi/12 -  pi/6) = sin 3pi/4 =  1 / sqrt2 answer
Answer Link

Otras preguntas

You save $10 on gas every week because you take the bus to school. you have class 5 days a week. what is your average benefit per day of taking the bus to schoo
The shadow of a building is 40 ft. long. The angle between the ground and the line to the sun is 35°. Draw a diagram and find the height of the building.
Math Question? Help needed.
Why can two igneous rocks have the same minerals but different names?
What is the oxidation number of o in na2so4?
According to excerpts, what motivated the banker to wager the bet?
What are the characteristics of Baroque Music? How would you describe Baroque music?
Two letters are selcted at random from the word " IDEAS". What is the probability of selecting 2 vowels?
Which behaviors might lead someone to have a low credit score?
butnal, butanone and, diethyl ether have different properties because the molecules of each compound differ in their